C20H22N4O2 — CID 98062301
5-methoxy-2-[[(1R,12R)-7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl]methyl]phenol (PubChem CID 98062301) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 5-methoxy-2-[[(1R,12R)-7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl]methyl]phenol.
| Compound Name | 5-methoxy-2-[[(1R,12R)-7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl]methyl]phenol |
|---|---|
| PubChem CID | 98062301 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 5-methoxy-2-[[(1R,12R)-7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl]methyl]phenol |
| SMILES | COc1ccc(CN2[C@@H]3CC[C@@H]2c2cnc4cc(C)nn4c2C3)c(O)c1 |
| InChI | InChI=1S/C20H22N4O2/c1-12-7-20-21-10-16-17-6-4-14(8-18(16)24(20)22-12)23(17)11-13-3-5-15(26-2)9-19(13)25/h3,5,7,9-10,14,17,25H,4,6,8,11H2,1-2H3/t14-,17-/m1/s1 |
| InChIKey | CHURFJISIMWOFF-RHSMWYFYSA-N |
| XLogP | 3.01 |
| TPSA | 62.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|