C23H26N4O3 — CID 98062847
(2R)-2-(3-methoxyphenoxy)-1-[(1R,12R)-7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl]butan-1-one (PubChem CID 98062847) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is (2R)-2-(3-methoxyphenoxy)-1-[(1R,12R)-7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl]butan-1-one.
| Compound Name | (2R)-2-(3-methoxyphenoxy)-1-[(1R,12R)-7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl]butan-1-one |
|---|---|
| PubChem CID | 98062847 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | (2R)-2-(3-methoxyphenoxy)-1-[(1R,12R)-7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl]butan-1-one |
| SMILES | CC[C@@H](Oc1cccc(OC)c1)C(=O)N1[C@@H]2CC[C@@H]1c1cnc3cc(C)nn3c1C2 |
| InChI | InChI=1S/C23H26N4O3/c1-4-21(30-17-7-5-6-16(12-17)29-3)23(28)26-15-8-9-19(26)18-13-24-22-10-14(2)25-27(22)20(18)11-15/h5-7,10,12-13,15,19,21H,4,8-9,11H2,1-3H3/t15-,19-,21-/m1/s1 |
| InChIKey | XWQXYHPONSFDKI-QFIXIFRTSA-N |
| XLogP | 3.49 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |