C21H23N5O4S — CID 98131841
4-methoxy-N-[2-[(1S,12S)-7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl]-2-oxoethyl]benzenesulfonamide (PubChem CID 98131841) has the molecular formula C21H23N5O4S and a molecular weight of 441.51 g/mol. Its IUPAC name is 4-methoxy-N-[2-[(1S,12S)-7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl]-2-oxoethyl]benzenesulfonamide.
| Compound Name | 4-methoxy-N-[2-[(1S,12S)-7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl]-2-oxoethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 98131841 |
| Molecular Formula | C21H23N5O4S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 4-methoxy-N-[2-[(1S,12S)-7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl]-2-oxoethyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCC(=O)N2[C@H]3CC[C@H]2c2cnc4cc(C)nn4c2C3)cc1 |
| InChI | InChI=1S/C21H23N5O4S/c1-13-9-20-22-11-17-18-8-3-14(10-19(17)26(20)24-13)25(18)21(27)12-23-31(28,29)16-6-4-15(30-2)5-7-16/h4-7,9,11,14,18,23H,3,8,10,12H2,1-2H3/t14-,18-/m0/s1 |
| InChIKey | DKDZIFHFMZASMF-KSSFIOAISA-N |
| XLogP | 1.61 |
| TPSA | 105.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |