C22H25N5O2 — CID 98136567
2-(dimethylamino)-1-[(1S,12S)-7-(4-methoxyphenyl)-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl]ethanone (PubChem CID 98136567) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is 2-(dimethylamino)-1-[(1S,12S)-7-(4-methoxyphenyl)-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl]ethanone.
| Compound Name | 2-(dimethylamino)-1-[(1S,12S)-7-(4-methoxyphenyl)-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl]ethanone |
|---|---|
| PubChem CID | 98136567 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 2-(dimethylamino)-1-[(1S,12S)-7-(4-methoxyphenyl)-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl]ethanone |
| SMILES | COc1ccc(-c2cc3ncc4c(n3n2)C[C@@H]2CC[C@@H]4N2C(=O)CN(C)C)cc1 |
| InChI | InChI=1S/C22H25N5O2/c1-25(2)13-22(28)26-15-6-9-19(26)17-12-23-21-11-18(24-27(21)20(17)10-15)14-4-7-16(29-3)8-5-14/h4-5,7-8,11-12,15,19H,6,9-10,13H2,1-3H3/t15-,19-/m0/s1 |
| InChIKey | SMXABMFKUMWJRQ-KXBFYZLASA-N |
| XLogP | 2.55 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |