C21H22N4O — CID 98136682
(1S,12S)-7-(4-methoxyphenyl)-15-prop-2-enyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraene (PubChem CID 98136682) has the molecular formula C21H22N4O and a molecular weight of 346.43 g/mol. Its IUPAC name is (1S,12S)-7-(4-methoxyphenyl)-15-prop-2-enyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraene.
| Compound Name | (1S,12S)-7-(4-methoxyphenyl)-15-prop-2-enyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraene |
|---|---|
| PubChem CID | 98136682 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (1S,12S)-7-(4-methoxyphenyl)-15-prop-2-enyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraene |
| SMILES | C=CCN1[C@H]2CC[C@H]1c1cnc3cc(-c4ccc(OC)cc4)nn3c1C2 |
| InChI | InChI=1S/C21H22N4O/c1-3-10-24-15-6-9-19(24)17-13-22-21-12-18(23-25(21)20(17)11-15)14-4-7-16(26-2)8-5-14/h3-5,7-8,12-13,15,19H,1,6,9-11H2,2H3/t15-,19-/m0/s1 |
| InChIKey | PTUMBEICHPMIGK-KXBFYZLASA-N |
| XLogP | 3.65 |
| TPSA | 42.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|