C18H15FN4O — CID 46968124
7-(3-fluorophenyl)-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraene-15-carbaldehyde (PubChem CID 46968124) has the molecular formula C18H15FN4O and a molecular weight of 322.34 g/mol. Its IUPAC name is 7-(3-fluorophenyl)-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraene-15-carbaldehyde.
| Compound Name | 7-(3-fluorophenyl)-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraene-15-carbaldehyde |
|---|---|
| PubChem CID | 46968124 |
| Molecular Formula | C18H15FN4O |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 7-(3-fluorophenyl)-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraene-15-carbaldehyde |
| SMILES | O=CN1C2CCC1c1cnc3cc(-c4cccc(F)c4)nn3c1C2 |
| InChI | InChI=1S/C18H15FN4O/c19-12-3-1-2-11(6-12)15-8-18-20-9-14-16-5-4-13(22(16)10-24)7-17(14)23(18)21-15/h1-3,6,8-10,13,16H,4-5,7H2 |
| InChIKey | ZBEGPSITDZQFOO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|