C24H23N5O — CID 98136477
(1R,12R)-7-(2-methoxyphenyl)-15-(pyridin-3-ylmethyl)-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraene (PubChem CID 98136477) has the molecular formula C24H23N5O and a molecular weight of 397.48 g/mol. Its IUPAC name is (1R,12R)-7-(2-methoxyphenyl)-15-(pyridin-3-ylmethyl)-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraene.
| Compound Name | (1R,12R)-7-(2-methoxyphenyl)-15-(pyridin-3-ylmethyl)-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraene |
|---|---|
| PubChem CID | 98136477 |
| Molecular Formula | C24H23N5O |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | (1R,12R)-7-(2-methoxyphenyl)-15-(pyridin-3-ylmethyl)-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraene |
| SMILES | COc1ccccc1-c1cc2ncc3c(n2n1)C[C@H]1CC[C@H]3N1Cc1cccnc1 |
| InChI | InChI=1S/C24H23N5O/c1-30-23-7-3-2-6-18(23)20-12-24-26-14-19-21-9-8-17(11-22(19)29(24)27-20)28(21)15-16-5-4-10-25-13-16/h2-7,10,12-14,17,21H,8-9,11,15H2,1H3/t17-,21-/m1/s1 |
| InChIKey | RYNGMXFDWNQYJK-DYESRHJHSA-N |
| XLogP | 4.06 |
| TPSA | 55.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |