C23H22N6O2 — CID 98136482
[(1R,12R)-7-(2-methoxyphenyl)-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl]-(2-methylpyrazol-3-yl)methanone (PubChem CID 98136482) has the molecular formula C23H22N6O2 and a molecular weight of 414.47 g/mol. Its IUPAC name is [(1R,12R)-7-(2-methoxyphenyl)-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl]-(2-methylpyrazol-3-yl)methanone.
| Compound Name | [(1R,12R)-7-(2-methoxyphenyl)-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl]-(2-methylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 98136482 |
| Molecular Formula | C23H22N6O2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | [(1R,12R)-7-(2-methoxyphenyl)-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl]-(2-methylpyrazol-3-yl)methanone |
| SMILES | COc1ccccc1-c1cc2ncc3c(n2n1)C[C@H]1CC[C@H]3N1C(=O)c1ccnn1C |
| InChI | InChI=1S/C23H22N6O2/c1-27-19(9-10-25-27)23(30)28-14-7-8-18(28)16-13-24-22-12-17(26-29(22)20(16)11-14)15-5-3-4-6-21(15)31-2/h3-6,9-10,12-14,18H,7-8,11H2,1-2H3/t14-,18-/m1/s1 |
| InChIKey | NHHHCYGYBYBNDX-RDTXWAMCSA-N |
| XLogP | 3.04 |
| TPSA | 77.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |