C17H20N6 — CID 98062329
(1S,12S)-7-methyl-15-[(2-methylpyrazol-3-yl)methyl]-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraene (PubChem CID 98062329) has the molecular formula C17H20N6 and a molecular weight of 308.39 g/mol. Its IUPAC name is (1S,12S)-7-methyl-15-[(2-methylpyrazol-3-yl)methyl]-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraene.
| Compound Name | (1S,12S)-7-methyl-15-[(2-methylpyrazol-3-yl)methyl]-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraene |
|---|---|
| PubChem CID | 98062329 |
| Molecular Formula | C17H20N6 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | (1S,12S)-7-methyl-15-[(2-methylpyrazol-3-yl)methyl]-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraene |
| SMILES | Cc1cc2ncc3c(n2n1)C[C@@H]1CC[C@@H]3N1Cc1ccnn1C |
| InChI | InChI=1S/C17H20N6/c1-11-7-17-18-9-14-15-4-3-12(8-16(14)23(17)20-11)22(15)10-13-5-6-19-21(13)2/h5-7,9,12,15H,3-4,8,10H2,1-2H3/t12-,15-/m0/s1 |
| InChIKey | LUYRDBPGEOGYDG-WFASDCNBSA-N |
| XLogP | 2.03 |
| TPSA | 51.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |