C20H22N4O2 — CID 110215008
2-methoxy-5-[(7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl)methyl]phenol (PubChem CID 110215008) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-methoxy-5-[(7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl)methyl]phenol.
| Compound Name | 2-methoxy-5-[(7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl)methyl]phenol |
|---|---|
| PubChem CID | 110215008 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 2-methoxy-5-[(7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl)methyl]phenol |
| SMILES | COc1ccc(CN2C3CCC2c2cnc4cc(C)nn4c2C3)cc1O |
| InChI | InChI=1S/C20H22N4O2/c1-12-7-20-21-10-15-16-5-4-14(9-17(15)24(20)22-12)23(16)11-13-3-6-19(26-2)18(25)8-13/h3,6-8,10,14,16,25H,4-5,9,11H2,1-2H3 |
| InChIKey | RJNSFZRMNLKJKJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 62.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |