C22H27NO3 — CID 51597284
(3aR,4S,7aR)-2-[(3-hydroxyphenyl)methyl]-4-(2-methoxyphenyl)-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol (PubChem CID 51597284) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is (3aR,4S,7aR)-2-[(3-hydroxyphenyl)methyl]-4-(2-methoxyphenyl)-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol.
| Compound Name | (3aR,4S,7aR)-2-[(3-hydroxyphenyl)methyl]-4-(2-methoxyphenyl)-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol |
|---|---|
| PubChem CID | 51597284 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | (3aR,4S,7aR)-2-[(3-hydroxyphenyl)methyl]-4-(2-methoxyphenyl)-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol |
| SMILES | COc1ccccc1[C@]1(O)CCC[C@H]2CN(Cc3cccc(O)c3)C[C@@H]21 |
| InChI | InChI=1S/C22H27NO3/c1-26-21-10-3-2-9-19(21)22(25)11-5-7-17-14-23(15-20(17)22)13-16-6-4-8-18(24)12-16/h2-4,6,8-10,12,17,20,24-25H,5,7,11,13-15H2,1H3/t17-,20-,22+/m0/s1 |
| InChIKey | LZHQUJSFDRRAFA-RBDMOPTHSA-N |
| XLogP | 3.52 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |