C21H23NO3 — CID 515985
3-[3,5-dimethyl-4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]phenyl]phenol (PubChem CID 515985) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is 3-[3,5-dimethyl-4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]phenyl]phenol.
| Compound Name | 3-[3,5-dimethyl-4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]phenyl]phenol |
|---|---|
| PubChem CID | 515985 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 3-[3,5-dimethyl-4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]phenyl]phenol |
| SMILES | Cc1cc(CCCOc2c(C)cc(-c3cccc(O)c3)cc2C)on1 |
| InChI | InChI=1S/C21H23NO3/c1-14-10-18(17-6-4-7-19(23)13-17)11-15(2)21(14)24-9-5-8-20-12-16(3)22-25-20/h4,6-7,10-13,23H,5,8-9H2,1-3H3 |
| InChIKey | HVIMWZNEGJAAKF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|