C24H18N2O5 — CID 51603576
(4R)-2-amino-4-[(2S)-1-(1,3-benzodioxol-5-yl)propan-2-yl]-5,10-dioxo-4H-benzo[g]chromene-3-carbonitrile (PubChem CID 51603576) has the molecular formula C24H18N2O5 and a molecular weight of 414.42 g/mol. Its IUPAC name is (4R)-2-amino-4-[(2S)-1-(1,3-benzodioxol-5-yl)propan-2-yl]-5,10-dioxo-4H-benzo[g]chromene-3-carbonitrile.
| Compound Name | (4R)-2-amino-4-[(2S)-1-(1,3-benzodioxol-5-yl)propan-2-yl]-5,10-dioxo-4H-benzo[g]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 51603576 |
| Molecular Formula | C24H18N2O5 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | (4R)-2-amino-4-[(2S)-1-(1,3-benzodioxol-5-yl)propan-2-yl]-5,10-dioxo-4H-benzo[g]chromene-3-carbonitrile |
| SMILES | C[C@@H](Cc1ccc2c(c1)OCO2)[C@@H]1C(C#N)=C(N)OC2=C1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C24H18N2O5/c1-12(8-13-6-7-17-18(9-13)30-11-29-17)19-16(10-25)24(26)31-23-20(19)21(27)14-4-2-3-5-15(14)22(23)28/h2-7,9,12,19H,8,11,26H2,1H3/t12-,19+/m0/s1 |
| InChIKey | BEZSWWFGVBWAEZ-HXPMCKFVSA-N |
| XLogP | 3.27 |
| TPSA | 111.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|