About (4S)-2-oxo-4-phenyl-3,4-dihydro-1H-pyrimidine-5-carbohydrazide
(4S)-2-oxo-4-phenyl-3,4-dihydro-1H-pyrimidine-5-carbohydrazide (PubChem CID 51604241) has the molecular formula C11H12N4O2
and a molecular weight of 232.24 g/mol. Its IUPAC name is (4S)-2-oxo-4-phenyl-3,4-dihydro-1H-pyrimidine-5-carbohydrazide.
Molecular Properties
| Compound Name | (4S)-2-oxo-4-phenyl-3,4-dihydro-1H-pyrimidine-5-carbohydrazide |
| PubChem CID | 51604241 |
| Molecular Formula | C11H12N4O2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | (4S)-2-oxo-4-phenyl-3,4-dihydro-1H-pyrimidine-5-carbohydrazide |
| SMILES | NNC(=O)C1=CNC(=O)N[C@H]1c1ccccc1 |
| InChI | InChI=1S/C11H12N4O2/c12-15-10(16)8-6-13-11(17)14-9(8)7-4-2-1-3-5-7/h1-6,9H,12H2,(H,15,16)(H2,13,14,17)/t9-/m0/s1 |
| InChIKey | LXIGTIWGYGDBGM-VIFPVBQESA-N |
| XLogP | -0.09 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4S)-2-oxo-4-phenyl-3,4-dihydro-1H-pyrimidine-5-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2-oxo-4-phenyl-3,4-dihydro-1H-pyrimidine-5-carbohydrazide?
The IUPAC name of (4S)-2-oxo-4-phenyl-3,4-dihydro-1H-pyrimidine-5-carbohydrazide (CID 51604241) is (4S)-2-oxo-4-phenyl-3,4-dihydro-1H-pyrimidine-5-carbohydrazide.
What is the SMILES notation for (4S)-2-oxo-4-phenyl-3,4-dihydro-1H-pyrimidine-5-carbohydrazide?
The canonical SMILES for (4S)-2-oxo-4-phenyl-3,4-dihydro-1H-pyrimidine-5-carbohydrazide is NNC(=O)C1=CNC(=O)N[C@H]1c1ccccc1.
What is the InChIKey of (4S)-2-oxo-4-phenyl-3,4-dihydro-1H-pyrimidine-5-carbohydrazide?
The InChIKey is LXIGTIWGYGDBGM-VIFPVBQESA-N. The full InChI is InChI=1S/C11H12N4O2/c12-15-10(16)8-6-13-11(17)14-9(8)7-4-2-1-3-5-7/h1-6,9H,12H2,(H,15,16)(H2,13,14,17)/t9-/m0/s1.
What are the key properties of (4S)-2-oxo-4-phenyl-3,4-dihydro-1H-pyrimidine-5-carbohydrazide?
(4S)-2-oxo-4-phenyl-3,4-dihydro-1H-pyrimidine-5-carbohydrazide has a molecular weight of 232.24 g/mol, XLogP of -0.09, 2 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2-oxo-4-phenyl-3,4-dihydro-1H-pyrimidine-5-carbohydrazide is sourced from PubChem (CID 51604241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).