C11H9N5O3S — CID 5160757
2-[(6-amino-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)diazenyl]benzoic acid (PubChem CID 5160757) has the molecular formula C11H9N5O3S and a molecular weight of 291.29 g/mol. Its IUPAC name is 2-[(6-amino-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)diazenyl]benzoic acid.
| Compound Name | 2-[(6-amino-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)diazenyl]benzoic acid |
|---|---|
| PubChem CID | 5160757 |
| Molecular Formula | C11H9N5O3S |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 2-[(6-amino-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)diazenyl]benzoic acid |
| SMILES | Nc1[nH]c(=S)[nH]c(=O)c1/N=N/c1ccccc1C(=O)O |
| InChI | InChI=1S/C11H9N5O3S/c12-8-7(9(17)14-11(20)13-8)16-15-6-4-2-1-3-5(6)10(18)19/h1-4H,(H,18,19)(H4,12,13,14,17,20)/b16-15+ |
| InChIKey | GUYXSWVYJFNEPQ-FOCLMDBBSA-N |
| XLogP | 2.13 |
| TPSA | 136.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|