C11H10N4O4 — CID 139232593
methyl 2-[(3-amino-5-oxo-2H-1,2-oxazol-4-yl)diazenyl]benzoate (PubChem CID 139232593) has the molecular formula C11H10N4O4 and a molecular weight of 262.23 g/mol. Its IUPAC name is methyl 2-[(3-amino-5-oxo-2H-1,2-oxazol-4-yl)diazenyl]benzoate.
| Compound Name | methyl 2-[(3-amino-5-oxo-2H-1,2-oxazol-4-yl)diazenyl]benzoate |
|---|---|
| PubChem CID | 139232593 |
| Molecular Formula | C11H10N4O4 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | methyl 2-[(3-amino-5-oxo-2H-1,2-oxazol-4-yl)diazenyl]benzoate |
| SMILES | COC(=O)c1ccccc1/N=N/c1c(N)[nH]oc1=O |
| InChI | InChI=1S/C11H10N4O4/c1-18-10(16)6-4-2-3-5-7(6)13-14-8-9(12)15-19-11(8)17/h2-5,15H,12H2,1H3/b14-13+ |
| InChIKey | UJFVPYYXRUIFSR-BUHFOSPRSA-N |
| XLogP | 1.75 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|