About methyl 3-oxo-1H-[1,2]oxazolo[4,3-c]quinoline-6-carboxylate
methyl 3-oxo-1H-[1,2]oxazolo[4,3-c]quinoline-6-carboxylate (PubChem CID 54772698) has the molecular formula C12H8N2O4
and a molecular weight of 244.21 g/mol. Its IUPAC name is methyl 3-oxo-1H-[1,2]oxazolo[4,3-c]quinoline-6-carboxylate.
Analyze methyl 3-oxo-1H-[1,2]oxazolo[4,3-c]quinoline-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-oxo-1H-[1,2]oxazolo[4,3-c]quinoline-6-carboxylate?
The IUPAC name of methyl 3-oxo-1H-[1,2]oxazolo[4,3-c]quinoline-6-carboxylate (CID 54772698) is methyl 3-oxo-1H-[1,2]oxazolo[4,3-c]quinoline-6-carboxylate.
What is the SMILES notation for methyl 3-oxo-1H-[1,2]oxazolo[4,3-c]quinoline-6-carboxylate?
The canonical SMILES for methyl 3-oxo-1H-[1,2]oxazolo[4,3-c]quinoline-6-carboxylate is COC(=O)c1cccc2c1ncc1c(=O)o[nH]c12.
What is the InChIKey of methyl 3-oxo-1H-[1,2]oxazolo[4,3-c]quinoline-6-carboxylate?
The InChIKey is WGSIBIDJMHTUSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O4/c1-17-11(15)7-4-2-3-6-9(7)13-5-8-10(6)14-18-12(8)16/h2-5,14H,1H3.
What are the key properties of methyl 3-oxo-1H-[1,2]oxazolo[4,3-c]quinoline-6-carboxylate?
methyl 3-oxo-1H-[1,2]oxazolo[4,3-c]quinoline-6-carboxylate has a molecular weight of 244.21 g/mol, XLogP of 1.46, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-oxo-1H-[1,2]oxazolo[4,3-c]quinoline-6-carboxylate is sourced from PubChem (CID 54772698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).