C31H25N5O3S — CID 5161143
2-cyano-N-[5-[(4-methoxyphenyl)methyl]-1,3-thiazol-2-yl]-3-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enamide (PubChem CID 5161143) has the molecular formula C31H25N5O3S and a molecular weight of 547.64 g/mol. Its IUPAC name is 2-cyano-N-[5-[(4-methoxyphenyl)methyl]-1,3-thiazol-2-yl]-3-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enamide.
| Compound Name | 2-cyano-N-[5-[(4-methoxyphenyl)methyl]-1,3-thiazol-2-yl]-3-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 5161143 |
| Molecular Formula | C31H25N5O3S |
| Molecular Weight | 547.64 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | 2-cyano-N-[5-[(4-methoxyphenyl)methyl]-1,3-thiazol-2-yl]-3-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enamide |
| SMILES | COc1ccc(Cc2cnc(NC(=O)C(C#N)=Cc3cn(-c4ccccc4)nc3-c3ccc(OC)cc3)s2)cc1 |
| InChI | InChI=1S/C31H25N5O3S/c1-38-26-12-8-21(9-13-26)16-28-19-33-31(40-28)34-30(37)23(18-32)17-24-20-36(25-6-4-3-5-7-25)35-29(24)22-10-14-27(39-2)15-11-22/h3-15,17,19-20H,16H2,1-2H3,(H,33,34,37) |
| InChIKey | YVJGHZSWTRIUOU-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.64 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|