C33H28ClN5OS — CID 6182305
(E)-N-[5-[(4-butylphenyl)methyl]-1,3-thiazol-2-yl]-3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-2-cyanoprop-2-enamide (PubChem CID 6182305) has the molecular formula C33H28ClN5OS and a molecular weight of 578.14 g/mol. Its IUPAC name is (E)-N-[5-[(4-butylphenyl)methyl]-1,3-thiazol-2-yl]-3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-2-cyanoprop-2-enamide.
| Compound Name | (E)-N-[5-[(4-butylphenyl)methyl]-1,3-thiazol-2-yl]-3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 6182305 |
| Molecular Formula | C33H28ClN5OS |
| Molecular Weight | 578.14 g/mol |
| Exact Mass | 577.17 |
| IUPAC Name | (E)-N-[5-[(4-butylphenyl)methyl]-1,3-thiazol-2-yl]-3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-2-cyanoprop-2-enamide |
| SMILES | CCCCc1ccc(Cc2cnc(NC(=O)/C(C#N)=C/c3cn(-c4ccccc4)nc3-c3ccc(Cl)cc3)s2)cc1 |
| InChI | InChI=1S/C33H28ClN5OS/c1-2-3-7-23-10-12-24(13-11-23)18-30-21-36-33(41-30)37-32(40)26(20-35)19-27-22-39(29-8-5-4-6-9-29)38-31(27)25-14-16-28(34)17-15-25/h4-6,8-17,19,21-22H,2-3,7,18H2,1H3,(H,36,37,40)/b26-19+ |
| InChIKey | OKVGMPUOLVUSRM-LGUFXXKBSA-N |
| XLogP | 8.13 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.14 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|