C24H24N4O2S3 — CID 5165237
1-[5-(dimethylsulfamoyl)-2-methylphenyl]-3-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]thiourea (PubChem CID 5165237) has the molecular formula C24H24N4O2S3 and a molecular weight of 496.68 g/mol. Its IUPAC name is 1-[5-(dimethylsulfamoyl)-2-methylphenyl]-3-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]thiourea.
| Compound Name | 1-[5-(dimethylsulfamoyl)-2-methylphenyl]-3-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 5165237 |
| Molecular Formula | C24H24N4O2S3 |
| Molecular Weight | 496.68 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | 1-[5-(dimethylsulfamoyl)-2-methylphenyl]-3-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]thiourea |
| SMILES | Cc1ccc2nc(-c3ccc(NC(=S)Nc4cc(S(=O)(=O)N(C)C)ccc4C)cc3)sc2c1 |
| InChI | InChI=1S/C24H24N4O2S3/c1-15-5-12-20-22(13-15)32-23(26-20)17-7-9-18(10-8-17)25-24(31)27-21-14-19(11-6-16(21)2)33(29,30)28(3)4/h5-14H,1-4H3,(H2,25,27,31) |
| InChIKey | CSAFEYHLIANYQY-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.68 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|