C27H25N3O2 — CID 51668656
4-[(3aS,4R,9bS)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]-N-[(Z)-(4-methoxyphenyl)methylideneamino]benzamide (PubChem CID 51668656) has the molecular formula C27H25N3O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 4-[(3aS,4R,9bS)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]-N-[(Z)-(4-methoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-[(3aS,4R,9bS)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]-N-[(Z)-(4-methoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 51668656 |
| Molecular Formula | C27H25N3O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 4-[(3aS,4R,9bS)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]-N-[(Z)-(4-methoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1ccc(/C=N\NC(=O)c2ccc([C@@H]3Nc4ccccc4[C@H]4C=CC[C@@H]43)cc2)cc1 |
| InChI | InChI=1S/C27H25N3O2/c1-32-21-15-9-18(10-16-21)17-28-30-27(31)20-13-11-19(12-14-20)26-24-7-4-6-22(24)23-5-2-3-8-25(23)29-26/h2-6,8-17,22,24,26,29H,7H2,1H3,(H,30,31)/b28-17-/t22-,24+,26+/m1/s1 |
| InChIKey | YLGRHVPNTDGRPW-MLSAGGHGSA-N |
| XLogP | 5.29 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|