C26H24N2O8S — CID 5167710
[4-[2-[2-[[2-(benzenesulfonamido)acetyl]amino]acetyl]oxyacetyl]phenyl] 4-methylbenzoate (PubChem CID 5167710) has the molecular formula C26H24N2O8S and a molecular weight of 524.55 g/mol. Its IUPAC name is [4-[2-[2-[[2-(benzenesulfonamido)acetyl]amino]acetyl]oxyacetyl]phenyl] 4-methylbenzoate.
| Compound Name | [4-[2-[2-[[2-(benzenesulfonamido)acetyl]amino]acetyl]oxyacetyl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 5167710 |
| Molecular Formula | C26H24N2O8S |
| Molecular Weight | 524.55 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | [4-[2-[2-[[2-(benzenesulfonamido)acetyl]amino]acetyl]oxyacetyl]phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(C(=O)COC(=O)CNC(=O)CNS(=O)(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H24N2O8S/c1-18-7-9-20(10-8-18)26(32)36-21-13-11-19(12-14-21)23(29)17-35-25(31)16-27-24(30)15-28-37(33,34)22-5-3-2-4-6-22/h2-14,28H,15-17H2,1H3,(H,27,30) |
| InChIKey | XILPORYJNGGRNS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.55 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|