C28H26N2O7 — CID 3920614
[2-(4-acetyloxyphenyl)-2-oxoethyl] 2-[[2-[(2,2-diphenylacetyl)amino]acetyl]amino]acetate (PubChem CID 3920614) has the molecular formula C28H26N2O7 and a molecular weight of 502.52 g/mol. Its IUPAC name is [2-(4-acetyloxyphenyl)-2-oxoethyl] 2-[[2-[(2,2-diphenylacetyl)amino]acetyl]amino]acetate.
| Compound Name | [2-(4-acetyloxyphenyl)-2-oxoethyl] 2-[[2-[(2,2-diphenylacetyl)amino]acetyl]amino]acetate |
|---|---|
| PubChem CID | 3920614 |
| Molecular Formula | C28H26N2O7 |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | [2-(4-acetyloxyphenyl)-2-oxoethyl] 2-[[2-[(2,2-diphenylacetyl)amino]acetyl]amino]acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)COC(=O)CNC(=O)CNC(=O)C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H26N2O7/c1-19(31)37-23-14-12-20(13-15-23)24(32)18-36-26(34)17-29-25(33)16-30-28(35)27(21-8-4-2-5-9-21)22-10-6-3-7-11-22/h2-15,27H,16-18H2,1H3,(H,29,33)(H,30,35) |
| InChIKey | YSHHZMVFQVSOAZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|