C17H22N4O3 — CID 51682555
(NZ)-N-[(1S,3R,4R)-3-[4-(4-nitrophenyl)piperazin-1-yl]-2-bicyclo[2.2.1]heptanylidene]hydroxylamine (PubChem CID 51682555) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is (NZ)-N-[(1S,3R,4R)-3-[4-(4-nitrophenyl)piperazin-1-yl]-2-bicyclo[2.2.1]heptanylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(1S,3R,4R)-3-[4-(4-nitrophenyl)piperazin-1-yl]-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
|---|---|
| PubChem CID | 51682555 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (NZ)-N-[(1S,3R,4R)-3-[4-(4-nitrophenyl)piperazin-1-yl]-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
| SMILES | O=[N+]([O-])c1ccc(N2CCN([C@H]3/C(=N\O)[C@H]4CC[C@@H]3C4)CC2)cc1 |
| InChI | InChI=1S/C17H22N4O3/c22-18-16-12-1-2-13(11-12)17(16)20-9-7-19(8-10-20)14-3-5-15(6-4-14)21(23)24/h3-6,12-13,17,22H,1-2,7-11H2/b18-16-/t12-,13+,17+/m0/s1 |
| InChIKey | ZCCKXNDQPASUOS-ZXYMDOCFSA-N |
| XLogP | 2.35 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|