C22H27FN6 — CID 51686580
1-(4-fluorophenyl)-4-[(S)-(4-methylphenyl)-(1-propan-2-yltetrazol-5-yl)methyl]piperazine (PubChem CID 51686580) has the molecular formula C22H27FN6 and a molecular weight of 394.50 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-[(S)-(4-methylphenyl)-(1-propan-2-yltetrazol-5-yl)methyl]piperazine.
| Compound Name | 1-(4-fluorophenyl)-4-[(S)-(4-methylphenyl)-(1-propan-2-yltetrazol-5-yl)methyl]piperazine |
|---|---|
| PubChem CID | 51686580 |
| Molecular Formula | C22H27FN6 |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 1-(4-fluorophenyl)-4-[(S)-(4-methylphenyl)-(1-propan-2-yltetrazol-5-yl)methyl]piperazine |
| SMILES | Cc1ccc([C@@H](c2nnnn2C(C)C)N2CCN(c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H27FN6/c1-16(2)29-22(24-25-26-29)21(18-6-4-17(3)5-7-18)28-14-12-27(13-15-28)20-10-8-19(23)9-11-20/h4-11,16,21H,12-15H2,1-3H3/t21-/m0/s1 |
| InChIKey | WTDREUDYSWIIKZ-NRFANRHFSA-N |
| XLogP | 3.61 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |