C24H29N5O3 — CID 51700698
(7S)-3-cyclohexyl-7-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-2,4-dione (PubChem CID 51700698) has the molecular formula C24H29N5O3 and a molecular weight of 435.53 g/mol. Its IUPAC name is (7S)-3-cyclohexyl-7-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-2,4-dione.
| Compound Name | (7S)-3-cyclohexyl-7-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 51700698 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | (7S)-3-cyclohexyl-7-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-2,4-dione |
| SMILES | Cc1c(N[C@H]2CCc3c2[nH]c(=O)n(C2CCCCC2)c3=O)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C24H29N5O3/c1-15-20(23(31)29(27(15)2)17-11-7-4-8-12-17)25-19-14-13-18-21(19)26-24(32)28(22(18)30)16-9-5-3-6-10-16/h4,7-8,11-12,16,19,25H,3,5-6,9-10,13-14H2,1-2H3,(H,26,32)/t19-/m0/s1 |
| InChIKey | MPMLYLFZNSBTHL-IBGZPJMESA-N |
| XLogP | 2.94 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |