C20H25N3O3 — CID 39847813
(7S)-3-cyclohexyl-7-(4-methoxyanilino)-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-2,4-dione (PubChem CID 39847813) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is (7S)-3-cyclohexyl-7-(4-methoxyanilino)-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-2,4-dione.
| Compound Name | (7S)-3-cyclohexyl-7-(4-methoxyanilino)-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 39847813 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | (7S)-3-cyclohexyl-7-(4-methoxyanilino)-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-2,4-dione |
| SMILES | COc1ccc(N[C@H]2CCc3c2[nH]c(=O)n(C2CCCCC2)c3=O)cc1 |
| InChI | InChI=1S/C20H25N3O3/c1-26-15-9-7-13(8-10-15)21-17-12-11-16-18(17)22-20(25)23(19(16)24)14-5-3-2-4-6-14/h7-10,14,17,21H,2-6,11-12H2,1H3,(H,22,25)/t17-/m0/s1 |
| InChIKey | SJQXGZIONMVSQT-KRWDZBQOSA-N |
| XLogP | 3.15 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|