C20H24N4O3 — CID 45133447
N'-(3-cyclohexyl-2,4-dioxo-1,5,6,7-tetrahydrocyclopenta[d]pyrimidin-7-yl)benzohydrazide (PubChem CID 45133447) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is N'-(3-cyclohexyl-2,4-dioxo-1,5,6,7-tetrahydrocyclopenta[d]pyrimidin-7-yl)benzohydrazide.
| Compound Name | N'-(3-cyclohexyl-2,4-dioxo-1,5,6,7-tetrahydrocyclopenta[d]pyrimidin-7-yl)benzohydrazide |
|---|---|
| PubChem CID | 45133447 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | N'-(3-cyclohexyl-2,4-dioxo-1,5,6,7-tetrahydrocyclopenta[d]pyrimidin-7-yl)benzohydrazide |
| SMILES | O=C(NNC1CCc2c1[nH]c(=O)n(C1CCCCC1)c2=O)c1ccccc1 |
| InChI | InChI=1S/C20H24N4O3/c25-18(13-7-3-1-4-8-13)23-22-16-12-11-15-17(16)21-20(27)24(19(15)26)14-9-5-2-6-10-14/h1,3-4,7-8,14,16,22H,2,5-6,9-12H2,(H,21,27)(H,23,25) |
| InChIKey | SIVZFDWGWMPBAM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|