C19H18N2O5 — CID 51703649
(2S)-2-[(4,5-dimethoxy-1H-indole-2-carbonyl)amino]-2-phenylacetic acid (PubChem CID 51703649) has the molecular formula C19H18N2O5 and a molecular weight of 354.36 g/mol. Its IUPAC name is (2S)-2-[(4,5-dimethoxy-1H-indole-2-carbonyl)amino]-2-phenylacetic acid.
| Compound Name | (2S)-2-[(4,5-dimethoxy-1H-indole-2-carbonyl)amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 51703649 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | (2S)-2-[(4,5-dimethoxy-1H-indole-2-carbonyl)amino]-2-phenylacetic acid |
| SMILES | COc1ccc2[nH]c(C(=O)N[C@H](C(=O)O)c3ccccc3)cc2c1OC |
| InChI | InChI=1S/C19H18N2O5/c1-25-15-9-8-13-12(17(15)26-2)10-14(20-13)18(22)21-16(19(23)24)11-6-4-3-5-7-11/h3-10,16,20H,1-2H3,(H,21,22)(H,23,24)/t16-/m0/s1 |
| InChIKey | IPHKFUFWTCLZCS-INIZCTEOSA-N |
| XLogP | 2.74 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |