C11H17N3OS2 — CID 5172669
1-butyl-3-[(5-methylthiophene-3-carbonyl)amino]thiourea (PubChem CID 5172669) has the molecular formula C11H17N3OS2 and a molecular weight of 271.41 g/mol. Its IUPAC name is 1-butyl-3-[(5-methylthiophene-3-carbonyl)amino]thiourea.
| Compound Name | 1-butyl-3-[(5-methylthiophene-3-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 5172669 |
| Molecular Formula | C11H17N3OS2 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 1-butyl-3-[(5-methylthiophene-3-carbonyl)amino]thiourea |
| SMILES | CCCCNC(=S)NNC(=O)c1csc(C)c1 |
| InChI | InChI=1S/C11H17N3OS2/c1-3-4-5-12-11(16)14-13-10(15)9-6-8(2)17-7-9/h6-7H,3-5H2,1-2H3,(H,13,15)(H2,12,14,16) |
| InChIKey | RZHQRHLUCMJPHQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|