C17H10N3O2- — CID 51802202
2-(4-methoxyphenyl)-1-oxidoindole-5,6-dicarbonitrile (PubChem CID 51802202) has the molecular formula C17H10N3O2- and a molecular weight of 288.29 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-1-oxidoindole-5,6-dicarbonitrile.
| Compound Name | 2-(4-methoxyphenyl)-1-oxidoindole-5,6-dicarbonitrile |
|---|---|
| PubChem CID | 51802202 |
| Molecular Formula | C17H10N3O2- |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 2-(4-methoxyphenyl)-1-oxidoindole-5,6-dicarbonitrile |
| SMILES | COc1ccc(-c2cc3cc(C#N)c(C#N)cc3n2[O-])cc1 |
| InChI | InChI=1S/C17H10N3O2/c1-22-15-4-2-11(3-5-15)16-7-12-6-13(9-18)14(10-19)8-17(12)20(16)21/h2-8H,1H3/q-1 |
| InChIKey | QAKFGWKNDIGDKX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 84.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|