C17H12N4O2 — CID 45490315
2-amino-1-hydroxy-3-(4-methoxyphenyl)indole-5,6-dicarbonitrile (PubChem CID 45490315) has the molecular formula C17H12N4O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is 2-amino-1-hydroxy-3-(4-methoxyphenyl)indole-5,6-dicarbonitrile.
| Compound Name | 2-amino-1-hydroxy-3-(4-methoxyphenyl)indole-5,6-dicarbonitrile |
|---|---|
| PubChem CID | 45490315 |
| Molecular Formula | C17H12N4O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 2-amino-1-hydroxy-3-(4-methoxyphenyl)indole-5,6-dicarbonitrile |
| SMILES | COc1ccc(-c2c(N)n(O)c3cc(C#N)c(C#N)cc23)cc1 |
| InChI | InChI=1S/C17H12N4O2/c1-23-13-4-2-10(3-5-13)16-14-6-11(8-18)12(9-19)7-15(14)21(22)17(16)20/h2-7,22H,20H2,1H3 |
| InChIKey | MEYDKYDLCUNRJN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 107.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|