C24H20N2O3 — CID 134976633
1-methoxy-2,3-bis(4-methoxyphenyl)indolizine-8-carbonitrile (PubChem CID 134976633) has the molecular formula C24H20N2O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is 1-methoxy-2,3-bis(4-methoxyphenyl)indolizine-8-carbonitrile.
| Compound Name | 1-methoxy-2,3-bis(4-methoxyphenyl)indolizine-8-carbonitrile |
|---|---|
| PubChem CID | 134976633 |
| Molecular Formula | C24H20N2O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 1-methoxy-2,3-bis(4-methoxyphenyl)indolizine-8-carbonitrile |
| SMILES | COc1ccc(-c2c(OC)c3c(C#N)cccn3c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H20N2O3/c1-27-19-10-6-16(7-11-19)21-22(17-8-12-20(28-2)13-9-17)26-14-4-5-18(15-25)23(26)24(21)29-3/h4-14H,1-3H3 |
| InChIKey | JFCZBYRPPIXLDL-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 55.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |