C25H30N4O5 — CID 51819657
6-[(10aR)-7,8-dimethoxy-1,3-dioxo-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-2-yl]-N-(pyridin-2-ylmethyl)hexanamide (PubChem CID 51819657) has the molecular formula C25H30N4O5 and a molecular weight of 466.54 g/mol. Its IUPAC name is 6-[(10aR)-7,8-dimethoxy-1,3-dioxo-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-2-yl]-N-(pyridin-2-ylmethyl)hexanamide.
| Compound Name | 6-[(10aR)-7,8-dimethoxy-1,3-dioxo-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-2-yl]-N-(pyridin-2-ylmethyl)hexanamide |
|---|---|
| PubChem CID | 51819657 |
| Molecular Formula | C25H30N4O5 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 6-[(10aR)-7,8-dimethoxy-1,3-dioxo-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-2-yl]-N-(pyridin-2-ylmethyl)hexanamide |
| SMILES | COc1cc2c(cc1OC)CN1C(=O)N(CCCCCC(=O)NCc3ccccn3)C(=O)[C@H]1C2 |
| InChI | InChI=1S/C25H30N4O5/c1-33-21-13-17-12-20-24(31)28(25(32)29(20)16-18(17)14-22(21)34-2)11-7-3-4-9-23(30)27-15-19-8-5-6-10-26-19/h5-6,8,10,13-14,20H,3-4,7,9,11-12,15-16H2,1-2H3,(H,27,30)/t20-/m1/s1 |
| InChIKey | MBRZUEYXMZDONI-HXUWFJFHSA-N |
| XLogP | 2.66 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|