C25H27N3O7 — CID 5185371
1-(2,3-dimethylphenyl)-5-[[5-methoxy-4-(3-methylbutoxy)-2-nitrophenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 5185371) has the molecular formula C25H27N3O7 and a molecular weight of 481.51 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-5-[[5-methoxy-4-(3-methylbutoxy)-2-nitrophenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(2,3-dimethylphenyl)-5-[[5-methoxy-4-(3-methylbutoxy)-2-nitrophenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 5185371 |
| Molecular Formula | C25H27N3O7 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-5-[[5-methoxy-4-(3-methylbutoxy)-2-nitrophenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | COc1cc(C=C2C(=O)NC(=O)N(c3cccc(C)c3C)C2=O)c([N+](=O)[O-])cc1OCCC(C)C |
| InChI | InChI=1S/C25H27N3O7/c1-14(2)9-10-35-22-13-20(28(32)33)17(12-21(22)34-5)11-18-23(29)26-25(31)27(24(18)30)19-8-6-7-15(3)16(19)4/h6-8,11-14H,9-10H2,1-5H3,(H,26,29,31) |
| InChIKey | MODSOLMFWGSFLA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|