C22H21Cl2N3O6 — CID 17354395
(4Z)-1-(3,4-dichlorophenyl)-4-[[5-methoxy-4-(3-methylbutoxy)-2-nitrophenyl]methylidene]pyrazolidine-3,5-dione (PubChem CID 17354395) has the molecular formula C22H21Cl2N3O6 and a molecular weight of 494.33 g/mol. Its IUPAC name is (4Z)-1-(3,4-dichlorophenyl)-4-[[5-methoxy-4-(3-methylbutoxy)-2-nitrophenyl]methylidene]pyrazolidine-3,5-dione.
| Compound Name | (4Z)-1-(3,4-dichlorophenyl)-4-[[5-methoxy-4-(3-methylbutoxy)-2-nitrophenyl]methylidene]pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 17354395 |
| Molecular Formula | C22H21Cl2N3O6 |
| Molecular Weight | 494.33 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | (4Z)-1-(3,4-dichlorophenyl)-4-[[5-methoxy-4-(3-methylbutoxy)-2-nitrophenyl]methylidene]pyrazolidine-3,5-dione |
| SMILES | COc1cc(/C=C2/C(=O)NN(c3ccc(Cl)c(Cl)c3)C2=O)c([N+](=O)[O-])cc1OCCC(C)C |
| InChI | InChI=1S/C22H21Cl2N3O6/c1-12(2)6-7-33-20-11-18(27(30)31)13(9-19(20)32-3)8-15-21(28)25-26(22(15)29)14-4-5-16(23)17(24)10-14/h4-5,8-12H,6-7H2,1-3H3,(H,25,28)/b15-8- |
| InChIKey | CESCABJPLUHKLR-NVNXTCNLSA-N |
| XLogP | 4.80 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.33 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|