C21H26ClNO — CID 51856008
1-adamantyl-[(2S)-2-(2-chlorophenyl)pyrrolidin-1-yl]methanone (PubChem CID 51856008) has the molecular formula C21H26ClNO and a molecular weight of 343.90 g/mol. Its IUPAC name is 1-adamantyl-[(2S)-2-(2-chlorophenyl)pyrrolidin-1-yl]methanone.
| Compound Name | 1-adamantyl-[(2S)-2-(2-chlorophenyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 51856008 |
| Molecular Formula | C21H26ClNO |
| Molecular Weight | 343.90 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 1-adamantyl-[(2S)-2-(2-chlorophenyl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(N1CCC[C@H]1c1ccccc1Cl)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H26ClNO/c22-18-5-2-1-4-17(18)19-6-3-7-23(19)20(24)21-11-14-8-15(12-21)10-16(9-14)13-21/h1-2,4-5,14-16,19H,3,6-13H2/t14?,15?,16?,19-,21?/m0/s1 |
| InChIKey | RUQBAUHFCRABTR-IXYLRAAXSA-N |
| XLogP | 5.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.90 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |