C22H29NO — CID 51856249
1-adamantyl-[(2S)-2-(2-methylphenyl)pyrrolidin-1-yl]methanone (PubChem CID 51856249) has the molecular formula C22H29NO and a molecular weight of 323.48 g/mol. Its IUPAC name is 1-adamantyl-[(2S)-2-(2-methylphenyl)pyrrolidin-1-yl]methanone.
| Compound Name | 1-adamantyl-[(2S)-2-(2-methylphenyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 51856249 |
| Molecular Formula | C22H29NO |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | 1-adamantyl-[(2S)-2-(2-methylphenyl)pyrrolidin-1-yl]methanone |
| SMILES | Cc1ccccc1[C@@H]1CCCN1C(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H29NO/c1-15-5-2-3-6-19(15)20-7-4-8-23(20)21(24)22-12-16-9-17(13-22)11-18(10-16)14-22/h2-3,5-6,16-18,20H,4,7-14H2,1H3/t16?,17?,18?,20-,22?/m0/s1 |
| InChIKey | YZGIPKCZOFGMQL-BUMILGAPSA-N |
| XLogP | 4.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |