C23H18ClN5O2 — CID 51881184
(2R)-N-(3-acetylphenyl)-2-[5-(4-chlorophenyl)tetrazol-2-yl]-2-phenylacetamide (PubChem CID 51881184) has the molecular formula C23H18ClN5O2 and a molecular weight of 431.88 g/mol. Its IUPAC name is (2R)-N-(3-acetylphenyl)-2-[5-(4-chlorophenyl)tetrazol-2-yl]-2-phenylacetamide.
| Compound Name | (2R)-N-(3-acetylphenyl)-2-[5-(4-chlorophenyl)tetrazol-2-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 51881184 |
| Molecular Formula | C23H18ClN5O2 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | (2R)-N-(3-acetylphenyl)-2-[5-(4-chlorophenyl)tetrazol-2-yl]-2-phenylacetamide |
| SMILES | CC(=O)c1cccc(NC(=O)[C@@H](c2ccccc2)n2nnc(-c3ccc(Cl)cc3)n2)c1 |
| InChI | InChI=1S/C23H18ClN5O2/c1-15(30)18-8-5-9-20(14-18)25-23(31)21(16-6-3-2-4-7-16)29-27-22(26-28-29)17-10-12-19(24)13-11-17/h2-14,21H,1H3,(H,25,31)/t21-/m1/s1 |
| InChIKey | GVKHWGKOTMAZCO-OAQYLSRUSA-N |
| XLogP | 4.42 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |