C22H31N3O2 — CID 51909631
4-[[(1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]amino]-N-phenylpiperidine-1-carboxamide (PubChem CID 51909631) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is 4-[[(1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]amino]-N-phenylpiperidine-1-carboxamide.
| Compound Name | 4-[[(1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]amino]-N-phenylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 51909631 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | 4-[[(1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]amino]-N-phenylpiperidine-1-carboxamide |
| SMILES | CC(C)=C[C@@H]1[C@@H](C(=O)NC2CCN(C(=O)Nc3ccccc3)CC2)C1(C)C |
| InChI | InChI=1S/C22H31N3O2/c1-15(2)14-18-19(22(18,3)4)20(26)23-17-10-12-25(13-11-17)21(27)24-16-8-6-5-7-9-16/h5-9,14,17-19H,10-13H2,1-4H3,(H,23,26)(H,24,27)/t18-,19+/m1/s1 |
| InChIKey | DJKNZUKRLHCUGI-MOPGFXCFSA-N |
| XLogP | 4.04 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|