C19H14BrN3O5S — CID 5191221
ethyl 5-[[2-(5-bromo-2,3-dioxoindol-1-yl)acetyl]amino]-4-cyano-3-methylthiophene-2-carboxylate (PubChem CID 5191221) has the molecular formula C19H14BrN3O5S and a molecular weight of 476.31 g/mol. Its IUPAC name is ethyl 5-[[2-(5-bromo-2,3-dioxoindol-1-yl)acetyl]amino]-4-cyano-3-methylthiophene-2-carboxylate.
| Compound Name | ethyl 5-[[2-(5-bromo-2,3-dioxoindol-1-yl)acetyl]amino]-4-cyano-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 5191221 |
| Molecular Formula | C19H14BrN3O5S |
| Molecular Weight | 476.31 g/mol |
| Exact Mass | 474.98 |
| IUPAC Name | ethyl 5-[[2-(5-bromo-2,3-dioxoindol-1-yl)acetyl]amino]-4-cyano-3-methylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)CN2C(=O)C(=O)c3cc(Br)ccc32)c(C#N)c1C |
| InChI | InChI=1S/C19H14BrN3O5S/c1-3-28-19(27)16-9(2)12(7-21)17(29-16)22-14(24)8-23-13-5-4-10(20)6-11(13)15(25)18(23)26/h4-6H,3,8H2,1-2H3,(H,22,24) |
| InChIKey | KOYSZUPMBAMYTJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|