C11H10ClNO5 — CID 51923271
(3S,5R)-3-(2-chloro-4-nitrophenoxy)-5-methyloxolan-2-one (PubChem CID 51923271) has the molecular formula C11H10ClNO5 and a molecular weight of 271.66 g/mol. Its IUPAC name is (3S,5R)-3-(2-chloro-4-nitrophenoxy)-5-methyloxolan-2-one.
| Compound Name | (3S,5R)-3-(2-chloro-4-nitrophenoxy)-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 51923271 |
| Molecular Formula | C11H10ClNO5 |
| Molecular Weight | 271.66 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | (3S,5R)-3-(2-chloro-4-nitrophenoxy)-5-methyloxolan-2-one |
| SMILES | C[C@@H]1C[C@H](Oc2ccc([N+](=O)[O-])cc2Cl)C(=O)O1 |
| InChI | InChI=1S/C11H10ClNO5/c1-6-4-10(11(14)17-6)18-9-3-2-7(13(15)16)5-8(9)12/h2-3,5-6,10H,4H2,1H3/t6-,10+/m1/s1 |
| InChIKey | LYXCGCGQNIJTMR-LDWIPMOCSA-N |
| XLogP | 2.33 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.66 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|