C18H18FNO4S — CID 51925377
N-[(3S)-1,1-dioxothiolan-3-yl]-3-[(4-fluorophenyl)methoxy]benzamide (PubChem CID 51925377) has the molecular formula C18H18FNO4S and a molecular weight of 363.41 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-3-[(4-fluorophenyl)methoxy]benzamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-3-[(4-fluorophenyl)methoxy]benzamide |
|---|---|
| PubChem CID | 51925377 |
| Molecular Formula | C18H18FNO4S |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-3-[(4-fluorophenyl)methoxy]benzamide |
| SMILES | O=C(N[C@H]1CCS(=O)(=O)C1)c1cccc(OCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C18H18FNO4S/c19-15-6-4-13(5-7-15)11-24-17-3-1-2-14(10-17)18(21)20-16-8-9-25(22,23)12-16/h1-7,10,16H,8-9,11-12H2,(H,20,21)/t16-/m0/s1 |
| InChIKey | KDTDLLDGFOAYAT-INIZCTEOSA-N |
| XLogP | 2.32 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |