C22H25N3O4 — CID 51933549
2-[(2R)-2-hydroxy-3-(2-prop-2-enylphenoxy)propyl]-1,3-dioxo-6,7,8,9-tetrahydro-5H-pyrimido[1,6-a]azepine-4-carbonitrile (PubChem CID 51933549) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-[(2R)-2-hydroxy-3-(2-prop-2-enylphenoxy)propyl]-1,3-dioxo-6,7,8,9-tetrahydro-5H-pyrimido[1,6-a]azepine-4-carbonitrile.
| Compound Name | 2-[(2R)-2-hydroxy-3-(2-prop-2-enylphenoxy)propyl]-1,3-dioxo-6,7,8,9-tetrahydro-5H-pyrimido[1,6-a]azepine-4-carbonitrile |
|---|---|
| PubChem CID | 51933549 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 2-[(2R)-2-hydroxy-3-(2-prop-2-enylphenoxy)propyl]-1,3-dioxo-6,7,8,9-tetrahydro-5H-pyrimido[1,6-a]azepine-4-carbonitrile |
| SMILES | C=CCc1ccccc1OC[C@H](O)Cn1c(=O)c(C#N)c2n(c1=O)CCCCC2 |
| InChI | InChI=1S/C22H25N3O4/c1-2-8-16-9-5-6-11-20(16)29-15-17(26)14-25-21(27)18(13-23)19-10-4-3-7-12-24(19)22(25)28/h2,5-6,9,11,17,26H,1,3-4,7-8,10,12,14-15H2/t17-/m1/s1 |
| InChIKey | KNJGKVSQFMFWFA-QGZVFWFLSA-N |
| XLogP | 1.78 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|