C17H19F3N4O4 — CID 51951038
2-[4-[(1S,2S)-2-nitrocyclopropanecarbonyl]piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 51951038) has the molecular formula C17H19F3N4O4 and a molecular weight of 400.36 g/mol. Its IUPAC name is 2-[4-[(1S,2S)-2-nitrocyclopropanecarbonyl]piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-[(1S,2S)-2-nitrocyclopropanecarbonyl]piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 51951038 |
| Molecular Formula | C17H19F3N4O4 |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 2-[4-[(1S,2S)-2-nitrocyclopropanecarbonyl]piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CN1CCN(C(=O)[C@H]2C[C@@H]2[N+](=O)[O-])CC1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H19F3N4O4/c18-17(19,20)12-3-1-2-4-13(12)21-15(25)10-22-5-7-23(8-6-22)16(26)11-9-14(11)24(27)28/h1-4,11,14H,5-10H2,(H,21,25)/t11-,14-/m0/s1 |
| InChIKey | CUUNWIMZQAIKKJ-FZMZJTMJSA-N |
| XLogP | 1.45 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|