C17H23ClF3N3O3 — CID 51953201
5-chloro-N-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propyl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide (PubChem CID 51953201) has the molecular formula C17H23ClF3N3O3 and a molecular weight of 409.84 g/mol. Its IUPAC name is 5-chloro-N-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propyl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide.
| Compound Name | 5-chloro-N-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propyl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 51953201 |
| Molecular Formula | C17H23ClF3N3O3 |
| Molecular Weight | 409.84 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 5-chloro-N-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propyl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide |
| SMILES | C[C@H]1CN(CCCNC(=O)c2cnc(OCC(F)(F)F)c(Cl)c2)C[C@H](C)O1 |
| InChI | InChI=1S/C17H23ClF3N3O3/c1-11-8-24(9-12(2)27-11)5-3-4-22-15(25)13-6-14(18)16(23-7-13)26-10-17(19,20)21/h6-7,11-12H,3-5,8-10H2,1-2H3,(H,22,25)/t11-,12-/m0/s1 |
| InChIKey | JAJFSPPZPXXNAV-RYUDHWBXSA-N |
| XLogP | 2.91 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.84 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|