C16H20N2O2S — CID 51957994
(2R)-N-[(1R)-1-(5-methylfuran-2-yl)ethyl]-2-thiophen-2-ylpyrrolidine-1-carboxamide (PubChem CID 51957994) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is (2R)-N-[(1R)-1-(5-methylfuran-2-yl)ethyl]-2-thiophen-2-ylpyrrolidine-1-carboxamide.
| Compound Name | (2R)-N-[(1R)-1-(5-methylfuran-2-yl)ethyl]-2-thiophen-2-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 51957994 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | (2R)-N-[(1R)-1-(5-methylfuran-2-yl)ethyl]-2-thiophen-2-ylpyrrolidine-1-carboxamide |
| SMILES | Cc1ccc([C@@H](C)NC(=O)N2CCC[C@@H]2c2cccs2)o1 |
| InChI | InChI=1S/C16H20N2O2S/c1-11-7-8-14(20-11)12(2)17-16(19)18-9-3-5-13(18)15-6-4-10-21-15/h4,6-8,10,12-13H,3,5,9H2,1-2H3,(H,17,19)/t12-,13-/m1/s1 |
| InChIKey | DDGLXBSMVNCDAR-CHWSQXEVSA-N |
| XLogP | 4.26 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |