C21H23F3N2O5 — CID 51962583
methyl (3R)-3-[2-(3-methylphenoxy)ethylcarbamoylamino]-3-[4-(trifluoromethoxy)phenyl]propanoate (PubChem CID 51962583) has the molecular formula C21H23F3N2O5 and a molecular weight of 440.42 g/mol. Its IUPAC name is methyl (3R)-3-[2-(3-methylphenoxy)ethylcarbamoylamino]-3-[4-(trifluoromethoxy)phenyl]propanoate.
| Compound Name | methyl (3R)-3-[2-(3-methylphenoxy)ethylcarbamoylamino]-3-[4-(trifluoromethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 51962583 |
| Molecular Formula | C21H23F3N2O5 |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | methyl (3R)-3-[2-(3-methylphenoxy)ethylcarbamoylamino]-3-[4-(trifluoromethoxy)phenyl]propanoate |
| SMILES | COC(=O)C[C@@H](NC(=O)NCCOc1cccc(C)c1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H23F3N2O5/c1-14-4-3-5-17(12-14)30-11-10-25-20(28)26-18(13-19(27)29-2)15-6-8-16(9-7-15)31-21(22,23)24/h3-9,12,18H,10-11,13H2,1-2H3,(H2,25,26,28)/t18-/m1/s1 |
| InChIKey | RHBKZUBLEBIMAG-GOSISDBHSA-N |
| XLogP | 3.88 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|