About (2S)-1-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-3-pyrazol-1-ylpropan-2-ol
(2S)-1-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-3-pyrazol-1-ylpropan-2-ol (PubChem CID 51964109) has the molecular formula C15H19Cl2N5O
and a molecular weight of 356.26 g/mol. Its IUPAC name is (2S)-1-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-3-pyrazol-1-ylpropan-2-ol.
Molecular Properties
| Compound Name | (2S)-1-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-3-pyrazol-1-ylpropan-2-ol |
| PubChem CID | 51964109 |
| Molecular Formula | C15H19Cl2N5O |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | (2S)-1-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-3-pyrazol-1-ylpropan-2-ol |
| SMILES | O[C@@H](CN1CCN(c2ncc(Cl)cc2Cl)CC1)Cn1cccn1 |
| InChI | InChI=1S/C15H19Cl2N5O/c16-12-8-14(17)15(18-9-12)21-6-4-20(5-7-21)10-13(23)11-22-3-1-2-19-22/h1-3,8-9,13,23H,4-7,10-11H2/t13-/m0/s1 |
| InChIKey | LYHDHUIXUBEBQK-ZDUSSCGKSA-N |
| XLogP | 1.77 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2S)-1-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-3-pyrazol-1-ylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-3-pyrazol-1-ylpropan-2-ol?
The IUPAC name of (2S)-1-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-3-pyrazol-1-ylpropan-2-ol (CID 51964109) is (2S)-1-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-3-pyrazol-1-ylpropan-2-ol.
What is the SMILES notation for (2S)-1-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-3-pyrazol-1-ylpropan-2-ol?
The canonical SMILES for (2S)-1-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-3-pyrazol-1-ylpropan-2-ol is O[C@@H](CN1CCN(c2ncc(Cl)cc2Cl)CC1)Cn1cccn1.
What is the InChIKey of (2S)-1-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-3-pyrazol-1-ylpropan-2-ol?
The InChIKey is LYHDHUIXUBEBQK-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H19Cl2N5O/c16-12-8-14(17)15(18-9-12)21-6-4-20(5-7-21)10-13(23)11-22-3-1-2-19-22/h1-3,8-9,13,23H,4-7,10-11H2/t13-/m0/s1.
What are the key properties of (2S)-1-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-3-pyrazol-1-ylpropan-2-ol?
(2S)-1-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-3-pyrazol-1-ylpropan-2-ol has a molecular weight of 356.26 g/mol, XLogP of 1.77, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-3-pyrazol-1-ylpropan-2-ol is sourced from PubChem (CID 51964109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).