C16H19N3O6S — CID 51964466
N-[(2R)-1-[4-(methanesulfonamido)-3-methoxyanilino]-1-oxopropan-2-yl]furan-3-carboxamide (PubChem CID 51964466) has the molecular formula C16H19N3O6S and a molecular weight of 381.41 g/mol. Its IUPAC name is N-[(2R)-1-[4-(methanesulfonamido)-3-methoxyanilino]-1-oxopropan-2-yl]furan-3-carboxamide.
| Compound Name | N-[(2R)-1-[4-(methanesulfonamido)-3-methoxyanilino]-1-oxopropan-2-yl]furan-3-carboxamide |
|---|---|
| PubChem CID | 51964466 |
| Molecular Formula | C16H19N3O6S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | N-[(2R)-1-[4-(methanesulfonamido)-3-methoxyanilino]-1-oxopropan-2-yl]furan-3-carboxamide |
| SMILES | COc1cc(NC(=O)[C@@H](C)NC(=O)c2ccoc2)ccc1NS(C)(=O)=O |
| InChI | InChI=1S/C16H19N3O6S/c1-10(17-16(21)11-6-7-25-9-11)15(20)18-12-4-5-13(14(8-12)24-2)19-26(3,22)23/h4-10,19H,1-3H3,(H,17,21)(H,18,20)/t10-/m1/s1 |
| InChIKey | GZXIHUONLWRVOX-SNVBAGLBSA-N |
| XLogP | 1.42 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |